C23H21FN2O3S2 — CID 98910939
(E)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enamide (PubChem CID 98910939) has the molecular formula C23H21FN2O3S2 and a molecular weight of 456.56 g/mol. Its IUPAC name is (E)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 98910939 |
| Molecular Formula | C23H21FN2O3S2 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (E)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2F)s1)NCc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C23H21FN2O3S2/c24-21-4-2-1-3-20(21)22-13-9-18(30-22)10-14-23(27)25-15-16-5-11-19(12-6-16)31(28,29)26-17-7-8-17/h1-6,9-14,17,26H,7-8,15H2,(H,25,27)/b14-10+ |
| InChIKey | HRKGRPMVVDQFNY-GXDHUFHOSA-N |
| XLogP | 4.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|