C19H12F3NOS — CID 68715960
(Z)-N-(2,3-difluorophenyl)-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enamide (PubChem CID 68715960) has the molecular formula C19H12F3NOS and a molecular weight of 359.37 g/mol. Its IUPAC name is (Z)-N-(2,3-difluorophenyl)-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enamide.
| Compound Name | (Z)-N-(2,3-difluorophenyl)-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 68715960 |
| Molecular Formula | C19H12F3NOS |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (Z)-N-(2,3-difluorophenyl)-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C\c1ccc(-c2ccccc2F)s1)Nc1cccc(F)c1F |
| InChI | InChI=1S/C19H12F3NOS/c20-14-5-2-1-4-13(14)17-10-8-12(25-17)9-11-18(24)23-16-7-3-6-15(21)19(16)22/h1-11H,(H,23,24)/b11-9- |
| InChIKey | XJFNZBWKISEXCS-LUAWRHEFSA-N |
| XLogP | 5.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|