C24H23FN2O2S — CID 46564232
(E)-3-[5-(2-fluorophenyl)thiophen-2-yl]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide (PubChem CID 46564232) has the molecular formula C24H23FN2O2S and a molecular weight of 422.53 g/mol. Its IUPAC name is (E)-3-[5-(2-fluorophenyl)thiophen-2-yl]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2-fluorophenyl)thiophen-2-yl]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 46564232 |
| Molecular Formula | C24H23FN2O2S |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (E)-3-[5-(2-fluorophenyl)thiophen-2-yl]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)/C=C/c2ccc(-c3ccccc3F)s2)c(C)c1 |
| InChI | InChI=1S/C24H23FN2O2S/c1-15-12-16(2)24(17(3)13-15)27-23(29)14-26-22(28)11-9-18-8-10-21(30-18)19-6-4-5-7-20(19)25/h4-13H,14H2,1-3H3,(H,26,28)(H,27,29)/b11-9+ |
| InChIKey | GEKLHSFTLZUZLH-PKNBQFBNSA-N |
| XLogP | 5.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|