C23H27N3O3 — CID 51164289
N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide (PubChem CID 51164289) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide.
| Compound Name | N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 51164289 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)C(C)NC(=O)/C=C/c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H27N3O3/c1-15-12-16(2)22(17(3)13-15)26-21(28)14-24-23(29)18(4)25-20(27)11-10-19-8-6-5-7-9-19/h5-13,18H,14H2,1-4H3,(H,24,29)(H,25,27)(H,26,28)/b11-10+ |
| InChIKey | NHYKYYSYRDDYAH-ZHACJKMWSA-N |
| XLogP | 2.88 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|