C27H27N3O3 — CID 55946553
4-methyl-N-[3-[[2-(3-phenylprop-2-enoylamino)propanoylamino]methyl]phenyl]benzamide (PubChem CID 55946553) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-methyl-N-[3-[[2-(3-phenylprop-2-enoylamino)propanoylamino]methyl]phenyl]benzamide.
| Compound Name | 4-methyl-N-[3-[[2-(3-phenylprop-2-enoylamino)propanoylamino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55946553 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 4-methyl-N-[3-[[2-(3-phenylprop-2-enoylamino)propanoylamino]methyl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(CNC(=O)C(C)NC(=O)C=Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H27N3O3/c1-19-11-14-23(15-12-19)27(33)30-24-10-6-9-22(17-24)18-28-26(32)20(2)29-25(31)16-13-21-7-4-3-5-8-21/h3-17,20H,18H2,1-2H3,(H,28,32)(H,29,31)(H,30,33) |
| InChIKey | RJIRLBHOYJLWGT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|