C22H19N3O2 — CID 108926500
N-[3-[[[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 108926500) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[3-[[[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108926500 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[3-[[[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(/C=C/c1ccccc1)NCc1cccc(NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C22H19N3O2/c26-21(12-11-17-6-2-1-3-7-17)24-15-18-8-4-10-20(14-18)25-22(27)19-9-5-13-23-16-19/h1-14,16H,15H2,(H,24,26)(H,25,27)/b12-11+ |
| InChIKey | RLNDCWRJMHUBNV-VAWYXSNFSA-N |
| XLogP | 3.66 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|