C22H17Cl2N3O2 — CID 55903196
N-[3-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]pyridine-4-carboxamide (PubChem CID 55903196) has the molecular formula C22H17Cl2N3O2 and a molecular weight of 426.30 g/mol. Its IUPAC name is N-[3-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55903196 |
| Molecular Formula | C22H17Cl2N3O2 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-[3-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCc1cccc(NC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C22H17Cl2N3O2/c23-19-6-4-15(13-20(19)24)5-7-21(28)26-14-16-2-1-3-18(12-16)27-22(29)17-8-10-25-11-9-17/h1-13H,14H2,(H,26,28)(H,27,29)/b7-5+ |
| InChIKey | MFGLJSARUJUVKP-FNORWQNLSA-N |
| XLogP | 4.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|