C23H17ClF3N3O2 — CID 55902946
N-[3-[[[(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]pyridine-4-carboxamide (PubChem CID 55902946) has the molecular formula C23H17ClF3N3O2 and a molecular weight of 459.86 g/mol. Its IUPAC name is N-[3-[[[(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[[(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55902946 |
| Molecular Formula | C23H17ClF3N3O2 |
| Molecular Weight | 459.86 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | N-[3-[[[(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(/C=C/c1cc(C(F)(F)F)ccc1Cl)NCc1cccc(NC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C23H17ClF3N3O2/c24-20-6-5-18(23(25,26)27)13-17(20)4-7-21(31)29-14-15-2-1-3-19(12-15)30-22(32)16-8-10-28-11-9-16/h1-13H,14H2,(H,29,31)(H,30,32)/b7-4+ |
| InChIKey | HANINTWUYDOTGT-QPJJXVBHSA-N |
| XLogP | 5.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.86 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|