C22H22ClF3N2O2 — CID 55971403
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 55971403) has the molecular formula C22H22ClF3N2O2 and a molecular weight of 438.88 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55971403 |
| Molecular Formula | C22H22ClF3N2O2 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(C(F)(F)F)ccc1Cl)NCc1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C22H22ClF3N2O2/c23-20-6-5-19(22(24,25)26)13-18(20)4-7-21(29)27-14-16-2-1-3-17(12-16)15-28-8-10-30-11-9-28/h1-7,12-13H,8-11,14-15H2,(H,27,29)/b7-4+ |
| InChIKey | LPOMSZAQTJRMFS-QPJJXVBHSA-N |
| XLogP | 4.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|