C12H8ClF6NO — CID 75982125
3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 75982125) has the molecular formula C12H8ClF6NO and a molecular weight of 331.64 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 75982125 |
| Molecular Formula | C12H8ClF6NO |
| Molecular Weight | 331.64 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cc(C(F)(F)F)ccc1Cl)NCC(F)(F)F |
| InChI | InChI=1S/C12H8ClF6NO/c13-9-3-2-8(12(17,18)19)5-7(9)1-4-10(21)20-6-11(14,15)16/h1-5H,6H2,(H,20,21) |
| InChIKey | NCYXUYQQTYWXQK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|