C11H9ClF3NO — CID 102603527
3-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 102603527) has the molecular formula C11H9ClF3NO and a molecular weight of 263.65 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 102603527 |
| Molecular Formula | C11H9ClF3NO |
| Molecular Weight | 263.65 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)NCC(F)(F)F |
| InChI | InChI=1S/C11H9ClF3NO/c12-9-4-1-8(2-5-9)3-6-10(17)16-7-11(13,14)15/h1-6H,7H2,(H,16,17) |
| InChIKey | URZSWKGHBXBVBS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|