C13H11F3N2O2 — CID 78780303
(E)-3-[4-(cyanomethoxy)phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 78780303) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is (E)-3-[4-(cyanomethoxy)phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(cyanomethoxy)phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 78780303 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (E)-3-[4-(cyanomethoxy)phenyl]-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | N#CCOc1ccc(/C=C/C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11F3N2O2/c14-13(15,16)9-18-12(19)6-3-10-1-4-11(5-2-10)20-8-7-17/h1-6H,8-9H2,(H,18,19)/b6-3+ |
| InChIKey | SZJUGOGPPCBDSA-ZZXKWVIFSA-N |
| XLogP | 2.28 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|