C16H14ClF3N4O — CID 75362300
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)prop-2-enehydrazide (PubChem CID 75362300) has the molecular formula C16H14ClF3N4O and a molecular weight of 370.76 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)prop-2-enehydrazide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 75362300 |
| Molecular Formula | C16H14ClF3N4O |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)prop-2-enehydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)/C=C/c2cc(C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C16H14ClF3N4O/c1-9-7-10(2)22-15(21-9)24-23-14(25)6-3-11-8-12(16(18,19)20)4-5-13(11)17/h3-8H,1-2H3,(H,23,25)(H,21,22,24)/b6-3+ |
| InChIKey | LNMSYRGDECBPSZ-ZZXKWVIFSA-N |
| XLogP | 3.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|