C15H15ClF3NO3 — CID 76857262
methyl 4-[3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoylamino]butanoate (PubChem CID 76857262) has the molecular formula C15H15ClF3NO3 and a molecular weight of 349.74 g/mol. Its IUPAC name is methyl 4-[3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoylamino]butanoate.
| Compound Name | methyl 4-[3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoylamino]butanoate |
|---|---|
| PubChem CID | 76857262 |
| Molecular Formula | C15H15ClF3NO3 |
| Molecular Weight | 349.74 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | methyl 4-[3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoylamino]butanoate |
| SMILES | COC(=O)CCCNC(=O)C=Cc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H15ClF3NO3/c1-23-14(22)3-2-8-20-13(21)7-4-10-9-11(15(17,18)19)5-6-12(10)16/h4-7,9H,2-3,8H2,1H3,(H,20,21) |
| InChIKey | MFZVGORSTIIEHL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|