C20H18ClF3N2O4 — CID 76870565
2-methoxyethyl N-[3-[3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoylamino]phenyl]carbamate (PubChem CID 76870565) has the molecular formula C20H18ClF3N2O4 and a molecular weight of 442.82 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoylamino]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 76870565 |
| Molecular Formula | C20H18ClF3N2O4 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-methoxyethyl N-[3-[3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enoylamino]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1cccc(NC(=O)C=Cc2cc(C(F)(F)F)ccc2Cl)c1 |
| InChI | InChI=1S/C20H18ClF3N2O4/c1-29-9-10-30-19(28)26-16-4-2-3-15(12-16)25-18(27)8-5-13-11-14(20(22,23)24)6-7-17(13)21/h2-8,11-12H,9-10H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | NFKBTMSUEPYHHY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|