C19H18ClF3N2O3 — CID 55717356
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]prop-2-enamide (PubChem CID 55717356) has the molecular formula C19H18ClF3N2O3 and a molecular weight of 414.81 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55717356 |
| Molecular Formula | C19H18ClF3N2O3 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]prop-2-enamide |
| SMILES | COCCOc1ncccc1CNC(=O)/C=C/c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H18ClF3N2O3/c1-27-9-10-28-18-14(3-2-8-24-18)12-25-17(26)7-4-13-11-15(19(21,22)23)5-6-16(13)20/h2-8,11H,9-10,12H2,1H3,(H,25,26)/b7-4+ |
| InChIKey | IWXXOLAYFNASFR-QPJJXVBHSA-N |
| XLogP | 4.11 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|