C19H21F3N2O2 — CID 52760208
N-[(2-butoxy-3-pyridinyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 52760208) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is N-[(2-butoxy-3-pyridinyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(2-butoxy-3-pyridinyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 52760208 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[(2-butoxy-3-pyridinyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCCOc1ncccc1CNC(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H21F3N2O2/c1-2-3-11-26-18-15(5-4-10-23-18)13-24-17(25)12-14-6-8-16(9-7-14)19(20,21)22/h4-10H,2-3,11-13H2,1H3,(H,24,25) |
| InChIKey | DLKYTHUKXMXDJE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|