C14H17ClF4N2O4 — CID 166427986
N-[(2-butoxy-3-pyridinyl)methyl]-2-chloro-2-fluoroacetamide;2,2,2-trifluoroacetic acid (PubChem CID 166427986) has the molecular formula C14H17ClF4N2O4 and a molecular weight of 388.75 g/mol. Its IUPAC name is N-[(2-butoxy-3-pyridinyl)methyl]-2-chloro-2-fluoroacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(2-butoxy-3-pyridinyl)methyl]-2-chloro-2-fluoroacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166427986 |
| Molecular Formula | C14H17ClF4N2O4 |
| Molecular Weight | 388.75 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | N-[(2-butoxy-3-pyridinyl)methyl]-2-chloro-2-fluoroacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCOc1ncccc1CNC(=O)C(F)Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H16ClFN2O2.C2HF3O2/c1-2-3-7-18-12-9(5-4-6-15-12)8-16-11(17)10(13)14;3-2(4,5)1(6)7/h4-6,10H,2-3,7-8H2,1H3,(H,16,17);(H,6,7) |
| InChIKey | MLDPOXDDQPDNDR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|