C14H20N2O2 — CID 126809112
N-[(2-butoxy-3-pyridinyl)methyl]but-2-enamide (PubChem CID 126809112) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-[(2-butoxy-3-pyridinyl)methyl]but-2-enamide.
| Compound Name | N-[(2-butoxy-3-pyridinyl)methyl]but-2-enamide |
|---|---|
| PubChem CID | 126809112 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-[(2-butoxy-3-pyridinyl)methyl]but-2-enamide |
| SMILES | CC=CC(=O)NCc1cccnc1OCCCC |
| InChI | InChI=1S/C14H20N2O2/c1-3-5-10-18-14-12(8-6-9-15-14)11-16-13(17)7-4-2/h4,6-9H,3,5,10-11H2,1-2H3,(H,16,17) |
| InChIKey | DDVGDWDLINZEOK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|