C17H16Cl2N2O3 — CID 56500151
(E)-3-(3,4-dichlorophenyl)-N-[2-(2-methoxyethoxy)-3-pyridinyl]prop-2-enamide (PubChem CID 56500151) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[2-(2-methoxyethoxy)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[2-(2-methoxyethoxy)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 56500151 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[2-(2-methoxyethoxy)-3-pyridinyl]prop-2-enamide |
| SMILES | COCCOc1ncccc1NC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-23-9-10-24-17-15(3-2-8-20-17)21-16(22)7-5-12-4-6-13(18)14(19)11-12/h2-8,11H,9-10H2,1H3,(H,21,22)/b7-5+ |
| InChIKey | FRZLIMYVDVMGDV-FNORWQNLSA-N |
| XLogP | 4.07 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|