C16H14Cl2N2O3S — CID 35368313
(E)-3-(3,4-dichlorophenyl)-N-[2-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 35368313) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[2-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[2-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 35368313 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[2-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | CS(=O)(=O)Nc1ccccc1NC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O3S/c1-24(22,23)20-15-5-3-2-4-14(15)19-16(21)9-7-11-6-8-12(17)13(18)10-11/h2-10,20H,1H3,(H,19,21)/b9-7+ |
| InChIKey | SMFOBIUABISURS-VQHVLOKHSA-N |
| XLogP | 4.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|