C19H13Cl2NOS — CID 16577559
(E)-3-(3,4-dichlorophenyl)-N-(2-thiophen-2-ylphenyl)prop-2-enamide (PubChem CID 16577559) has the molecular formula C19H13Cl2NOS and a molecular weight of 374.29 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-(2-thiophen-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-(2-thiophen-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16577559 |
| Molecular Formula | C19H13Cl2NOS |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-(2-thiophen-2-ylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)Nc1ccccc1-c1cccs1 |
| InChI | InChI=1S/C19H13Cl2NOS/c20-15-9-7-13(12-16(15)21)8-10-19(23)22-17-5-2-1-4-14(17)18-6-3-11-24-18/h1-12H,(H,22,23)/b10-8+ |
| InChIKey | YKGZACBQTDTNRR-CSKARUKUSA-N |
| XLogP | 6.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|