C22H14Cl3NO2 — CID 4184511
N-(2-benzoyl-4-chlorophenyl)-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 4184511) has the molecular formula C22H14Cl3NO2 and a molecular weight of 430.72 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4184511 |
| Molecular Formula | C22H14Cl3NO2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H14Cl3NO2/c23-16-8-10-20(17(13-16)22(28)15-4-2-1-3-5-15)26-21(27)11-7-14-6-9-18(24)19(25)12-14/h1-13H,(H,26,27) |
| InChIKey | UACOHRDSIQCNML-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|