C28H28ClNO4 — CID 2788968
N-(2-benzoyl-4-chlorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide (PubChem CID 2788968) has the molecular formula C28H28ClNO4 and a molecular weight of 477.99 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2788968 |
| Molecular Formula | C28H28ClNO4 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
| SMILES | CCCCCOc1ccc(C=CC(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C28H28ClNO4/c1-3-4-8-17-34-25-15-11-20(18-26(25)33-2)12-16-27(31)30-24-14-13-22(29)19-23(24)28(32)21-9-6-5-7-10-21/h5-7,9-16,18-19H,3-4,8,17H2,1-2H3,(H,30,31) |
| InChIKey | SPDFROLTLDCFMM-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|