C26H24ClNO4 — CID 4583304
N-(2-benzoyl-4-chlorophenyl)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide (PubChem CID 4583304) has the molecular formula C26H24ClNO4 and a molecular weight of 449.93 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4583304 |
| Molecular Formula | C26H24ClNO4 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)ccc1OC(C)C |
| InChI | InChI=1S/C26H24ClNO4/c1-17(2)32-23-13-9-18(15-24(23)31-3)10-14-25(29)28-22-12-11-20(27)16-21(22)26(30)19-7-5-4-6-8-19/h4-17H,1-3H3,(H,28,29) |
| InChIKey | QTBQUZUDPYTUTF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|