C17H10Cl2INOS — CID 16577558
3,5-dichloro-2-iodo-N-(2-thiophen-2-ylphenyl)benzamide (PubChem CID 16577558) has the molecular formula C17H10Cl2INOS and a molecular weight of 474.15 g/mol. Its IUPAC name is 3,5-dichloro-2-iodo-N-(2-thiophen-2-ylphenyl)benzamide.
| Compound Name | 3,5-dichloro-2-iodo-N-(2-thiophen-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 16577558 |
| Molecular Formula | C17H10Cl2INOS |
| Molecular Weight | 474.15 g/mol |
| Exact Mass | 472.89 |
| IUPAC Name | 3,5-dichloro-2-iodo-N-(2-thiophen-2-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1-c1cccs1)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C17H10Cl2INOS/c18-10-8-12(16(20)13(19)9-10)17(22)21-14-5-2-1-4-11(14)15-6-3-7-23-15/h1-9H,(H,21,22) |
| InChIKey | CJTHKUJRCRXAQP-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.15 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|