C21H19ClN2O2S — CID 55469548
4-chloro-N-[4-oxo-4-(2-thiophen-2-ylanilino)butyl]benzamide (PubChem CID 55469548) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is 4-chloro-N-[4-oxo-4-(2-thiophen-2-ylanilino)butyl]benzamide.
| Compound Name | 4-chloro-N-[4-oxo-4-(2-thiophen-2-ylanilino)butyl]benzamide |
|---|---|
| PubChem CID | 55469548 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-chloro-N-[4-oxo-4-(2-thiophen-2-ylanilino)butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)Nc1ccccc1-c1cccs1 |
| InChI | InChI=1S/C21H19ClN2O2S/c22-16-11-9-15(10-12-16)21(26)23-13-3-8-20(25)24-18-6-2-1-5-17(18)19-7-4-14-27-19/h1-2,4-7,9-12,14H,3,8,13H2,(H,23,26)(H,24,25) |
| InChIKey | AJHNXVOXFZYBRI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|