C23H26ClN3O3 — CID 26905508
4-chloro-N-[4-oxo-4-[2-(piperidine-1-carbonyl)anilino]butyl]benzamide (PubChem CID 26905508) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 4-chloro-N-[4-oxo-4-[2-(piperidine-1-carbonyl)anilino]butyl]benzamide.
| Compound Name | 4-chloro-N-[4-oxo-4-[2-(piperidine-1-carbonyl)anilino]butyl]benzamide |
|---|---|
| PubChem CID | 26905508 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-chloro-N-[4-oxo-4-[2-(piperidine-1-carbonyl)anilino]butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)Nc1ccccc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H26ClN3O3/c24-18-12-10-17(11-13-18)22(29)25-14-6-9-21(28)26-20-8-3-2-7-19(20)23(30)27-15-4-1-5-16-27/h2-3,7-8,10-13H,1,4-6,9,14-16H2,(H,25,29)(H,26,28) |
| InChIKey | XIUAIEIWXGXVLE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|