C24H28ClN3O4 — CID 55727316
N-[4-[4-chloro-2-(pyrrolidine-1-carbonyl)anilino]-4-oxobutyl]-2-ethoxybenzamide (PubChem CID 55727316) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is N-[4-[4-chloro-2-(pyrrolidine-1-carbonyl)anilino]-4-oxobutyl]-2-ethoxybenzamide.
| Compound Name | N-[4-[4-chloro-2-(pyrrolidine-1-carbonyl)anilino]-4-oxobutyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 55727316 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[4-[4-chloro-2-(pyrrolidine-1-carbonyl)anilino]-4-oxobutyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)Nc1ccc(Cl)cc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C24H28ClN3O4/c1-2-32-21-9-4-3-8-18(21)23(30)26-13-7-10-22(29)27-20-12-11-17(25)16-19(20)24(31)28-14-5-6-15-28/h3-4,8-9,11-12,16H,2,5-7,10,13-15H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | GCTHLHMHORKRTF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|