C20H22F2N2O4 — CID 51237492
N-[4-[2-(difluoromethoxy)anilino]-4-oxobutyl]-2-ethoxybenzamide (PubChem CID 51237492) has the molecular formula C20H22F2N2O4 and a molecular weight of 392.40 g/mol. Its IUPAC name is N-[4-[2-(difluoromethoxy)anilino]-4-oxobutyl]-2-ethoxybenzamide.
| Compound Name | N-[4-[2-(difluoromethoxy)anilino]-4-oxobutyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 51237492 |
| Molecular Formula | C20H22F2N2O4 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[4-[2-(difluoromethoxy)anilino]-4-oxobutyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C20H22F2N2O4/c1-2-27-16-10-5-3-8-14(16)19(26)23-13-7-12-18(25)24-15-9-4-6-11-17(15)28-20(21)22/h3-6,8-11,20H,2,7,12-13H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | OOIBJPTWZQEANR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|