C26H27F2N3O3 — CID 67218627
N-[6-(2-anilinoanilino)-6-oxohexyl]-2-(difluoromethoxy)benzamide (PubChem CID 67218627) has the molecular formula C26H27F2N3O3 and a molecular weight of 467.52 g/mol. Its IUPAC name is N-[6-(2-anilinoanilino)-6-oxohexyl]-2-(difluoromethoxy)benzamide.
| Compound Name | N-[6-(2-anilinoanilino)-6-oxohexyl]-2-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 67218627 |
| Molecular Formula | C26H27F2N3O3 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[6-(2-anilinoanilino)-6-oxohexyl]-2-(difluoromethoxy)benzamide |
| SMILES | O=C(CCCCCNC(=O)c1ccccc1OC(F)F)Nc1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C26H27F2N3O3/c27-26(28)34-23-16-9-6-13-20(23)25(33)29-18-10-2-5-17-24(32)31-22-15-8-7-14-21(22)30-19-11-3-1-4-12-19/h1,3-4,6-9,11-16,26,30H,2,5,10,17-18H2,(H,29,33)(H,31,32) |
| InChIKey | LZPZMIGVQKZIOB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|