C16H16ClN3O3S — CID 26469275
N-[4-[(4-acetyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-4-chlorobenzamide (PubChem CID 26469275) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is N-[4-[(4-acetyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-4-chlorobenzamide.
| Compound Name | N-[4-[(4-acetyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 26469275 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-[4-[(4-acetyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-4-chlorobenzamide |
| SMILES | CC(=O)c1csc(NC(=O)CCCNC(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-10(21)13-9-24-16(19-13)20-14(22)3-2-8-18-15(23)11-4-6-12(17)7-5-11/h4-7,9H,2-3,8H2,1H3,(H,18,23)(H,19,20,22) |
| InChIKey | UWEYMTBWHKOBQV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|