C16H18ClN3O2S — CID 46113972
N-butyl-2-[[2-(4-chlorophenyl)acetyl]amino]-1,3-thiazole-4-carboxamide (PubChem CID 46113972) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-chlorophenyl)acetyl]amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-[[2-(4-chlorophenyl)acetyl]amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46113972 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-butyl-2-[[2-(4-chlorophenyl)acetyl]amino]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(NC(=O)Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H18ClN3O2S/c1-2-3-8-18-15(22)13-10-23-16(19-13)20-14(21)9-11-4-6-12(17)7-5-11/h4-7,10H,2-3,8-9H2,1H3,(H,18,22)(H,19,20,21) |
| InChIKey | HSYGGTYZKOZBBI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|