C15H19ClN4OS — CID 122182342
2-(4-chloroanilino)-N-[3-(dimethylamino)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 122182342) has the molecular formula C15H19ClN4OS and a molecular weight of 338.86 g/mol. Its IUPAC name is 2-(4-chloroanilino)-N-[3-(dimethylamino)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-chloroanilino)-N-[3-(dimethylamino)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 122182342 |
| Molecular Formula | C15H19ClN4OS |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(4-chloroanilino)-N-[3-(dimethylamino)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1csc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H19ClN4OS/c1-20(2)9-3-8-17-14(21)13-10-22-15(19-13)18-12-6-4-11(16)5-7-12/h4-7,10H,3,8-9H2,1-2H3,(H,17,21)(H,18,19) |
| InChIKey | SBAIMWOKOKGMKK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|