C22H24Cl2N4OS — CID 86574827
2-(4-chloroanilino)-N-[5-[(3-chlorophenyl)methylamino]pentyl]-1,3-thiazole-4-carboxamide (PubChem CID 86574827) has the molecular formula C22H24Cl2N4OS and a molecular weight of 463.43 g/mol. Its IUPAC name is 2-(4-chloroanilino)-N-[5-[(3-chlorophenyl)methylamino]pentyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-chloroanilino)-N-[5-[(3-chlorophenyl)methylamino]pentyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 86574827 |
| Molecular Formula | C22H24Cl2N4OS |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-(4-chloroanilino)-N-[5-[(3-chlorophenyl)methylamino]pentyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCCCNCc1cccc(Cl)c1)c1csc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C22H24Cl2N4OS/c23-17-7-9-19(10-8-17)27-22-28-20(15-30-22)21(29)26-12-3-1-2-11-25-14-16-5-4-6-18(24)13-16/h4-10,13,15,25H,1-3,11-12,14H2,(H,26,29)(H,27,28) |
| InChIKey | HXGNWEOGEPTJFL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|