C20H19ClN4O2S — CID 16948802
2-[(3-chlorophenyl)carbamoylamino]-N-(3-phenylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 16948802) has the molecular formula C20H19ClN4O2S and a molecular weight of 414.92 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)carbamoylamino]-N-(3-phenylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)carbamoylamino]-N-(3-phenylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16948802 |
| Molecular Formula | C20H19ClN4O2S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[(3-chlorophenyl)carbamoylamino]-N-(3-phenylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1nc(C(=O)NCCCc2ccccc2)cs1 |
| InChI | InChI=1S/C20H19ClN4O2S/c21-15-9-4-10-16(12-15)23-19(27)25-20-24-17(13-28-20)18(26)22-11-5-8-14-6-2-1-3-7-14/h1-4,6-7,9-10,12-13H,5,8,11H2,(H,22,26)(H2,23,24,25,27) |
| InChIKey | QRIPSRSWKHNZEE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|