C13H13ClN2OS — CID 47443636
N-[2-(3-chlorophenyl)ethyl]-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 47443636) has the molecular formula C13H13ClN2OS and a molecular weight of 280.78 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 47443636 |
| Molecular Formula | C13H13ClN2OS |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NCCc2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C13H13ClN2OS/c1-9-16-12(8-18-9)13(17)15-6-5-10-3-2-4-11(14)7-10/h2-4,7-8H,5-6H2,1H3,(H,15,17) |
| InChIKey | DXYSAHQEYRPORY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |