C21H19ClIN3O3S — CID 11563067
N-[2-(3-chlorophenyl)ethyl]-2-[[[2-(4-iodophenoxy)acetyl]amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 11563067) has the molecular formula C21H19ClIN3O3S and a molecular weight of 555.83 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-[[[2-(4-iodophenoxy)acetyl]amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-[[[2-(4-iodophenoxy)acetyl]amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 11563067 |
| Molecular Formula | C21H19ClIN3O3S |
| Molecular Weight | 555.83 g/mol |
| Exact Mass | 554.99 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-[[[2-(4-iodophenoxy)acetyl]amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(COc1ccc(I)cc1)NCc1nc(C(=O)NCCc2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C21H19ClIN3O3S/c22-15-3-1-2-14(10-15)8-9-24-21(28)18-13-30-20(26-18)11-25-19(27)12-29-17-6-4-16(23)5-7-17/h1-7,10,13H,8-9,11-12H2,(H,24,28)(H,25,27) |
| InChIKey | SNMLNYKRFCQQPM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|