C16H17ClN2O3S — CID 119220176
6-[[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]amino]hexanoic acid (PubChem CID 119220176) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 6-[[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119220176 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 6-[[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1csc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C16H17ClN2O3S/c17-12-6-4-5-11(9-12)16-19-13(10-23-16)15(22)18-8-3-1-2-7-14(20)21/h4-6,9-10H,1-3,7-8H2,(H,18,22)(H,20,21) |
| InChIKey | PHZGNJGJJAUBBN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|