C16H17FN2O3S — CID 119235215
5-[[2-[(2-fluorophenyl)methyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid (PubChem CID 119235215) has the molecular formula C16H17FN2O3S and a molecular weight of 336.39 g/mol. Its IUPAC name is 5-[[2-[(2-fluorophenyl)methyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[2-[(2-fluorophenyl)methyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119235215 |
| Molecular Formula | C16H17FN2O3S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 5-[[2-[(2-fluorophenyl)methyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)c1csc(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C16H17FN2O3S/c17-12-6-2-1-5-11(12)9-14-19-13(10-23-14)16(22)18-8-4-3-7-15(20)21/h1-2,5-6,10H,3-4,7-9H2,(H,18,22)(H,20,21) |
| InChIKey | RFCNVDPFEVLTTD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|