C10H14N2O3S — CID 65199563
5-[(2-methyl-1,3-thiazole-4-carbonyl)amino]pentanoic acid (PubChem CID 65199563) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-[(2-methyl-1,3-thiazole-4-carbonyl)amino]pentanoic acid.
| Compound Name | 5-[(2-methyl-1,3-thiazole-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 65199563 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 5-[(2-methyl-1,3-thiazole-4-carbonyl)amino]pentanoic acid |
| SMILES | Cc1nc(C(=O)NCCCCC(=O)O)cs1 |
| InChI | InChI=1S/C10H14N2O3S/c1-7-12-8(6-16-7)10(15)11-5-3-2-4-9(13)14/h6H,2-5H2,1H3,(H,11,15)(H,13,14) |
| InChIKey | BUPHWVQPPOBQHJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|