C10H15IN2OS — CID 107322343
N-(5-iodopentyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 107322343) has the molecular formula C10H15IN2OS and a molecular weight of 338.21 g/mol. Its IUPAC name is N-(5-iodopentyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(5-iodopentyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 107322343 |
| Molecular Formula | C10H15IN2OS |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | N-(5-iodopentyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NCCCCCI)cs1 |
| InChI | InChI=1S/C10H15IN2OS/c1-8-13-9(7-15-8)10(14)12-6-4-2-3-5-11/h7H,2-6H2,1H3,(H,12,14) |
| InChIKey | BMZQWXGARAGCBT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|