C7H9BrN2OS — CID 65198942
N-(2-bromoethyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 65198942) has the molecular formula C7H9BrN2OS and a molecular weight of 249.13 g/mol. Its IUPAC name is N-(2-bromoethyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-bromoethyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65198942 |
| Molecular Formula | C7H9BrN2OS |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | N-(2-bromoethyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NCCBr)cs1 |
| InChI | InChI=1S/C7H9BrN2OS/c1-5-10-6(4-12-5)7(11)9-3-2-8/h4H,2-3H2,1H3,(H,9,11) |
| InChIKey | XICUINKSIYHJCJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|