C7H12N2O2S — CID 90101890
N,2-dimethyl-1,3-thiazole-4-carboxamide;methanol (PubChem CID 90101890) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is N,2-dimethyl-1,3-thiazole-4-carboxamide;methanol.
| Compound Name | N,2-dimethyl-1,3-thiazole-4-carboxamide;methanol |
|---|---|
| PubChem CID | 90101890 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | N,2-dimethyl-1,3-thiazole-4-carboxamide;methanol |
| SMILES | CNC(=O)c1csc(C)n1.CO |
| InChI | InChI=1S/C6H8N2OS.CH4O/c1-4-8-5(3-10-4)6(9)7-2;1-2/h3H,1-2H3,(H,7,9);2H,1H3 |
| InChIKey | ZFVDXBZHNKZGIJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |