C16H15N3O2S — CID 90550228
2-methyl-N-[3-[2-(methylcarbamoyl)phenyl]prop-2-ynyl]-1,3-thiazole-4-carboxamide (PubChem CID 90550228) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-methyl-N-[3-[2-(methylcarbamoyl)phenyl]prop-2-ynyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-methyl-N-[3-[2-(methylcarbamoyl)phenyl]prop-2-ynyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90550228 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-methyl-N-[3-[2-(methylcarbamoyl)phenyl]prop-2-ynyl]-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1ccccc1C#CCNC(=O)c1csc(C)n1 |
| InChI | InChI=1S/C16H15N3O2S/c1-11-19-14(10-22-11)16(21)18-9-5-7-12-6-3-4-8-13(12)15(20)17-2/h3-4,6,8,10H,9H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | RFOMKFKTUINBAO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|