C6H8N4OS2 — CID 65214512
[(2-methyl-1,3-thiazole-4-carbonyl)amino]thiourea (PubChem CID 65214512) has the molecular formula C6H8N4OS2 and a molecular weight of 216.29 g/mol. Its IUPAC name is [(2-methyl-1,3-thiazole-4-carbonyl)amino]thiourea.
| Compound Name | [(2-methyl-1,3-thiazole-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 65214512 |
| Molecular Formula | C6H8N4OS2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | [(2-methyl-1,3-thiazole-4-carbonyl)amino]thiourea |
| SMILES | Cc1nc(C(=O)NNC(N)=S)cs1 |
| InChI | InChI=1S/C6H8N4OS2/c1-3-8-4(2-13-3)5(11)9-10-6(7)12/h2H,1H3,(H,9,11)(H3,7,10,12) |
| InChIKey | GMLFNDWJMOKFPB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|