C7H9N3OS2 — CID 65214886
[(3-methylthiophene-2-carbonyl)amino]thiourea (PubChem CID 65214886) has the molecular formula C7H9N3OS2 and a molecular weight of 215.30 g/mol. Its IUPAC name is [(3-methylthiophene-2-carbonyl)amino]thiourea.
| Compound Name | [(3-methylthiophene-2-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 65214886 |
| Molecular Formula | C7H9N3OS2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | [(3-methylthiophene-2-carbonyl)amino]thiourea |
| SMILES | Cc1ccsc1C(=O)NNC(N)=S |
| InChI | InChI=1S/C7H9N3OS2/c1-4-2-3-13-5(4)6(11)9-10-7(8)12/h2-3H,1H3,(H,9,11)(H3,8,10,12) |
| InChIKey | JFJJLCAONVZQBA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|