C7H9N3O2S — CID 63001953
[(3-methylthiophene-2-carbonyl)amino]urea (PubChem CID 63001953) has the molecular formula C7H9N3O2S and a molecular weight of 199.24 g/mol. Its IUPAC name is [(3-methylthiophene-2-carbonyl)amino]urea.
| Compound Name | [(3-methylthiophene-2-carbonyl)amino]urea |
|---|---|
| PubChem CID | 63001953 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | [(3-methylthiophene-2-carbonyl)amino]urea |
| SMILES | Cc1ccsc1C(=O)NNC(N)=O |
| InChI | InChI=1S/C7H9N3O2S/c1-4-2-3-13-5(4)6(11)9-10-7(8)12/h2-3H,1H3,(H,9,11)(H3,8,10,12) |
| InChIKey | GEUCXBIIOXHYEM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|