C9H14N2OS — CID 130616224
N-[(2S)-1-aminopropan-2-yl]-3-methylthiophene-2-carboxamide (PubChem CID 130616224) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 130616224 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)N[C@@H](C)CN |
| InChI | InChI=1S/C9H14N2OS/c1-6-3-4-13-8(6)9(12)11-7(2)5-10/h3-4,7H,5,10H2,1-2H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | HULNFPDCCYPUDR-ZETCQYMHSA-N |
| XLogP | 1.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |