C10H15NO2S — CID 51969435
N-[(2R)-1-methoxypropan-2-yl]-3-methylthiophene-2-carboxamide (PubChem CID 51969435) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is N-[(2R)-1-methoxypropan-2-yl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[(2R)-1-methoxypropan-2-yl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 51969435 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N-[(2R)-1-methoxypropan-2-yl]-3-methylthiophene-2-carboxamide |
| SMILES | COC[C@@H](C)NC(=O)c1sccc1C |
| InChI | InChI=1S/C10H15NO2S/c1-7-4-5-14-9(7)10(12)11-8(2)6-13-3/h4-5,8H,6H2,1-3H3,(H,11,12)/t8-/m1/s1 |
| InChIKey | FEFGCKKLPDGWPL-MRVPVSSYSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |